C10H19F3O2Si — CID 15084333
1,1,1-trifluoro-7-trimethylsilyloxyheptan-2-one (PubChem CID 15084333) has the molecular formula C10H19F3O2Si and a molecular weight of 256.34 g/mol. Its IUPAC name is 1,1,1-trifluoro-7-trimethylsilyloxyheptan-2-one.
| Compound Name | 1,1,1-trifluoro-7-trimethylsilyloxyheptan-2-one |
|---|---|
| PubChem CID | 15084333 |
| Molecular Formula | C10H19F3O2Si |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1,1,1-trifluoro-7-trimethylsilyloxyheptan-2-one |
| SMILES | C[Si](C)(C)OCCCCCC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H19F3O2Si/c1-16(2,3)15-8-6-4-5-7-9(14)10(11,12)13/h4-8H2,1-3H3 |
| InChIKey | YAVDEBZGVLSJHP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|