C12H23F3O2Si — CID 19793848
6-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluorohexan-2-one (PubChem CID 19793848) has the molecular formula C12H23F3O2Si and a molecular weight of 284.39 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluorohexan-2-one.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluorohexan-2-one |
|---|---|
| PubChem CID | 19793848 |
| Molecular Formula | C12H23F3O2Si |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluorohexan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H23F3O2Si/c1-11(2,3)18(4,5)17-9-7-6-8-10(16)12(13,14)15/h6-9H2,1-5H3 |
| InChIKey | UPGFIRJWVCZFPN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|