C20H17ClN6O2 — CID 150844827
1-[3-[[6-[2-(4-chlorophenoxy)pyrimidin-5-yl]pyrazin-2-yl]amino]azetidin-1-yl]prop-2-en-1-one (PubChem CID 150844827) has the molecular formula C20H17ClN6O2 and a molecular weight of 408.85 g/mol. Its IUPAC name is 1-[3-[[6-[2-(4-chlorophenoxy)pyrimidin-5-yl]pyrazin-2-yl]amino]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[6-[2-(4-chlorophenoxy)pyrimidin-5-yl]pyrazin-2-yl]amino]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 150844827 |
| Molecular Formula | C20H17ClN6O2 |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 1-[3-[[6-[2-(4-chlorophenoxy)pyrimidin-5-yl]pyrazin-2-yl]amino]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(Nc2cncc(-c3cnc(Oc4ccc(Cl)cc4)nc3)n2)C1 |
| InChI | InChI=1S/C20H17ClN6O2/c1-2-19(28)27-11-15(12-27)25-18-10-22-9-17(26-18)13-7-23-20(24-8-13)29-16-5-3-14(21)4-6-16/h2-10,15H,1,11-12H2,(H,25,26) |
| InChIKey | KOTNEADOEAFILF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|