C21H24FNO3S — CID 150859352
1-cyclopropyl-2-[2-(ethoxymethoxy)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-(2-fluorophenyl)ethanone (PubChem CID 150859352) has the molecular formula C21H24FNO3S and a molecular weight of 389.49 g/mol. Its IUPAC name is 1-cyclopropyl-2-[2-(ethoxymethoxy)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-(2-fluorophenyl)ethanone.
| Compound Name | 1-cyclopropyl-2-[2-(ethoxymethoxy)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 150859352 |
| Molecular Formula | C21H24FNO3S |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-cyclopropyl-2-[2-(ethoxymethoxy)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-(2-fluorophenyl)ethanone |
| SMILES | CCOCOc1cc2c(s1)CCN(C(C(=O)C1CC1)c1ccccc1F)C2 |
| InChI | InChI=1S/C21H24FNO3S/c1-2-25-13-26-19-11-15-12-23(10-9-18(15)27-19)20(21(24)14-7-8-14)16-5-3-4-6-17(16)22/h3-6,11,14,20H,2,7-10,12-13H2,1H3 |
| InChIKey | KRRICBZZAPJSFI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|