C20H19FN4O3S — CID 90206751
[5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] 2-azidoacetate (PubChem CID 90206751) has the molecular formula C20H19FN4O3S and a molecular weight of 414.46 g/mol. Its IUPAC name is [5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] 2-azidoacetate.
| Compound Name | [5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] 2-azidoacetate |
|---|---|
| PubChem CID | 90206751 |
| Molecular Formula | C20H19FN4O3S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] 2-azidoacetate |
| SMILES | [N-]=[N+]=NCC(=O)Oc1cc2c(s1)CCN(C(C(=O)C1CC1)c1ccccc1F)C2 |
| InChI | InChI=1S/C20H19FN4O3S/c21-15-4-2-1-3-14(15)19(20(27)12-5-6-12)25-8-7-16-13(11-25)9-18(29-16)28-17(26)10-23-24-22/h1-4,9,12,19H,5-8,10-11H2 |
| InChIKey | QIXPUNNBRNKXJS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|