C20H22BrFN4O — CID 15085987
1-[4-(2-fluorophenyl)phenyl]-2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)ethanone bromide (PubChem CID 15085987) has the molecular formula C20H22BrFN4O and a molecular weight of 433.33 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)phenyl]-2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)ethanone bromide.
| Compound Name | 1-[4-(2-fluorophenyl)phenyl]-2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)ethanone bromide |
|---|---|
| PubChem CID | 15085987 |
| Molecular Formula | C20H22BrFN4O |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 1-[4-(2-fluorophenyl)phenyl]-2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)ethanone bromide |
| SMILES | O=C(C[N+]12CN3CN(CN(C3)C1)C2)c1ccc(-c2ccccc2F)cc1.[Br-] |
| InChI | InChI=1S/C20H22FN4O.BrH/c21-19-4-2-1-3-18(19)16-5-7-17(8-6-16)20(26)9-25-13-22-10-23(14-25)12-24(11-22)15-25;/h1-8H,9-15H2;1H/q+1;/p-1 |
| InChIKey | FVEIYPRKSBJBLT-UHFFFAOYSA-M |
| XLogP | -0.81 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|