C15H18F3N4O+ — CID 15085990
2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)-1-[4-(trifluoromethyl)phenyl]ethanone (PubChem CID 15085990) has the molecular formula C15H18F3N4O+ and a molecular weight of 327.33 g/mol. Its IUPAC name is 2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)-1-[4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)-1-[4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 15085990 |
| Molecular Formula | C15H18F3N4O+ |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)-1-[4-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(C[N+]12CN3CN(CN(C3)C1)C2)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H18F3N4O/c16-15(17,18)13-3-1-12(2-4-13)14(23)5-22-9-19-6-20(10-22)8-21(7-19)11-22/h1-4H,5-11H2/q+1 |
| InChIKey | ZYIXNJDUSMWOEU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|