C34H37F5O — CID 150865654
1-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-2-fluoro-6-[2-(4-heptylcyclohexyl)ethyl]naphthalene (PubChem CID 150865654) has the molecular formula C34H37F5O and a molecular weight of 556.66 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-2-fluoro-6-[2-(4-heptylcyclohexyl)ethyl]naphthalene.
| Compound Name | 1-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-2-fluoro-6-[2-(4-heptylcyclohexyl)ethyl]naphthalene |
|---|---|
| PubChem CID | 150865654 |
| Molecular Formula | C34H37F5O |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-2-fluoro-6-[2-(4-heptylcyclohexyl)ethyl]naphthalene |
| SMILES | CCCCCCCC1CCC(CCc2ccc3c(C#Cc4cc(F)c(OC(F)F)c(F)c4)c(F)ccc3c2)CC1 |
| InChI | InChI=1S/C34H37F5O/c1-2-3-4-5-6-7-23-8-10-24(11-9-23)12-13-25-14-17-28-27(20-25)16-19-30(35)29(28)18-15-26-21-31(36)33(32(37)22-26)40-34(38)39/h14,16-17,19-24,34H,2-13H2,1H3 |
| InChIKey | KSZJPRDFJBCFTE-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|