C23H16F6NO- — CID 150872098
2,6-bis[[4-(trifluoromethyl)phenyl]methyl]benzenecarboximidate (PubChem CID 150872098) has the molecular formula C23H16F6NO- and a molecular weight of 436.38 g/mol. Its IUPAC name is 2,6-bis[[4-(trifluoromethyl)phenyl]methyl]benzenecarboximidate.
| Compound Name | 2,6-bis[[4-(trifluoromethyl)phenyl]methyl]benzenecarboximidate |
|---|---|
| PubChem CID | 150872098 |
| Molecular Formula | C23H16F6NO- |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2,6-bis[[4-(trifluoromethyl)phenyl]methyl]benzenecarboximidate |
| SMILES | [H]/N=C(\[O-])c1c(Cc2ccc(C(F)(F)F)cc2)cccc1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17F6NO/c24-22(25,26)18-8-4-14(5-9-18)12-16-2-1-3-17(20(16)21(30)31)13-15-6-10-19(11-7-15)23(27,28)29/h1-11H,12-13H2,(H2,30,31)/p-1 |
| InChIKey | KUGDSCVMKFQKBP-UHFFFAOYSA-M |
| XLogP | 5.59 |
| TPSA | 46.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|