C16H16O6 — CID 150875584
2-[3-(3,4-dihydroxyphenyl)-5-methoxyphenyl]ethyl hydrogen carbonate (PubChem CID 150875584) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-[3-(3,4-dihydroxyphenyl)-5-methoxyphenyl]ethyl hydrogen carbonate.
| Compound Name | 2-[3-(3,4-dihydroxyphenyl)-5-methoxyphenyl]ethyl hydrogen carbonate |
|---|---|
| PubChem CID | 150875584 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-[3-(3,4-dihydroxyphenyl)-5-methoxyphenyl]ethyl hydrogen carbonate |
| SMILES | COc1cc(CCOC(=O)O)cc(-c2ccc(O)c(O)c2)c1 |
| InChI | InChI=1S/C16H16O6/c1-21-13-7-10(4-5-22-16(19)20)6-12(8-13)11-2-3-14(17)15(18)9-11/h2-3,6-9,17-18H,4-5H2,1H3,(H,19,20) |
| InChIKey | KUXYFZNIWGCUKI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|