C20H22BrNO — CID 150888149
(1R,4R,5S)-2-benzyl-4-(3-bromophenoxy)-2-azabicyclo[3.2.1]octane (PubChem CID 150888149) has the molecular formula C20H22BrNO and a molecular weight of 372.31 g/mol. Its IUPAC name is (1R,4R,5S)-2-benzyl-4-(3-bromophenoxy)-2-azabicyclo[3.2.1]octane.
| Compound Name | (1R,4R,5S)-2-benzyl-4-(3-bromophenoxy)-2-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 150888149 |
| Molecular Formula | C20H22BrNO |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (1R,4R,5S)-2-benzyl-4-(3-bromophenoxy)-2-azabicyclo[3.2.1]octane |
| SMILES | Brc1cccc(O[C@H]2CN(Cc3ccccc3)[C@@H]3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C20H22BrNO/c21-17-7-4-8-19(12-17)23-20-14-22(18-10-9-16(20)11-18)13-15-5-2-1-3-6-15/h1-8,12,16,18,20H,9-11,13-14H2/t16-,18+,20-/m0/s1 |
| InChIKey | KXLPHVOKGHKBEG-HQRMLTQVSA-N |
| XLogP | 4.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |