About 2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane
2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane (PubChem CID 150894005) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane.
Molecular Properties
| Compound Name | 2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane |
| PubChem CID | 150894005 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane |
| SMILES | CC=COCCCC1(C)COCCO1 |
| InChI | InChI=1S/C11H20O3/c1-3-6-12-7-4-5-11(2)10-13-8-9-14-11/h3,6H,4-5,7-10H2,1-2H3 |
| InChIKey | KYPJPNKEDWXXRZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane?
The IUPAC name of 2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane (CID 150894005) is 2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane.
What is the SMILES notation for 2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane?
The canonical SMILES for 2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane is CC=COCCCC1(C)COCCO1.
What is the InChIKey of 2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane?
The InChIKey is KYPJPNKEDWXXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-3-6-12-7-4-5-11(2)10-13-8-9-14-11/h3,6H,4-5,7-10H2,1-2H3.
What are the key properties of 2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane?
2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane has a molecular weight of 200.28 g/mol, XLogP of 2.12, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(3-prop-1-enoxypropyl)-1,4-dioxane is sourced from PubChem (CID 150894005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).