C16H30O3 — CID 152536600
5-(3-but-1-enoxypropyl)-2,2,3,3,5-pentamethyl-1,4-dioxane (PubChem CID 152536600) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 5-(3-but-1-enoxypropyl)-2,2,3,3,5-pentamethyl-1,4-dioxane.
| Compound Name | 5-(3-but-1-enoxypropyl)-2,2,3,3,5-pentamethyl-1,4-dioxane |
|---|---|
| PubChem CID | 152536600 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 5-(3-but-1-enoxypropyl)-2,2,3,3,5-pentamethyl-1,4-dioxane |
| SMILES | CCC=COCCCC1(C)COC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H30O3/c1-7-8-11-17-12-9-10-16(6)13-18-14(2,3)15(4,5)19-16/h8,11H,7,9-10,12-13H2,1-6H3 |
| InChIKey | YKQZVFNNBZXQLW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|