C9H21N4OP — CID 150895188
3-[bis(propan-2-ylamino)phosphorylamino]propanenitrile (PubChem CID 150895188) has the molecular formula C9H21N4OP and a molecular weight of 232.27 g/mol. Its IUPAC name is 3-[bis(propan-2-ylamino)phosphorylamino]propanenitrile.
| Compound Name | 3-[bis(propan-2-ylamino)phosphorylamino]propanenitrile |
|---|---|
| PubChem CID | 150895188 |
| Molecular Formula | C9H21N4OP |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 3-[bis(propan-2-ylamino)phosphorylamino]propanenitrile |
| SMILES | CC(C)NP(=O)(NCCC#N)NC(C)C |
| InChI | InChI=1S/C9H21N4OP/c1-8(2)12-15(14,13-9(3)4)11-7-5-6-10/h8-9H,5,7H2,1-4H3,(H3,11,12,13,14) |
| InChIKey | KYVORNFOZKIPHS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|