C7H15N3 — CID 172788770
3-(2,2-diethylhydrazinyl)propanenitrile (PubChem CID 172788770) has the molecular formula C7H15N3 and a molecular weight of 141.22 g/mol. Its IUPAC name is 3-(2,2-diethylhydrazinyl)propanenitrile.
| Compound Name | 3-(2,2-diethylhydrazinyl)propanenitrile |
|---|---|
| PubChem CID | 172788770 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 3-(2,2-diethylhydrazinyl)propanenitrile |
| SMILES | CCN(CC)NCCC#N |
| InChI | InChI=1S/C7H15N3/c1-3-10(4-2)9-7-5-6-8/h9H,3-5,7H2,1-2H3 |
| InChIKey | PGQOCHDGNBLCAV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|