C7H19N3 — CID 55290275
3-(2,2-diethylhydrazinyl)propan-1-amine (PubChem CID 55290275) has the molecular formula C7H19N3 and a molecular weight of 145.25 g/mol. Its IUPAC name is 3-(2,2-diethylhydrazinyl)propan-1-amine.
| Compound Name | 3-(2,2-diethylhydrazinyl)propan-1-amine |
|---|---|
| PubChem CID | 55290275 |
| Molecular Formula | C7H19N3 |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.16 |
| IUPAC Name | 3-(2,2-diethylhydrazinyl)propan-1-amine |
| SMILES | CCN(CC)NCCCN |
| InChI | InChI=1S/C7H19N3/c1-3-10(4-2)9-7-5-6-8/h9H,3-8H2,1-2H3 |
| InChIKey | KAOUBTBEIUZRKB-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|