C4H13N3S — CID 170190484
N-(3-aminopropylamino)-N-methylthiohydroxylamine (PubChem CID 170190484) has the molecular formula C4H13N3S and a molecular weight of 135.24 g/mol. Its IUPAC name is N-(3-aminopropylamino)-N-methylthiohydroxylamine.
| Compound Name | N-(3-aminopropylamino)-N-methylthiohydroxylamine |
|---|---|
| PubChem CID | 170190484 |
| Molecular Formula | C4H13N3S |
| Molecular Weight | 135.24 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | N-(3-aminopropylamino)-N-methylthiohydroxylamine |
| SMILES | CN(S)NCCCN |
| InChI | InChI=1S/C4H13N3S/c1-7(8)6-4-2-3-5/h6,8H,2-5H2,1H3 |
| InChIKey | XZSUGMMOIKOEKY-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.24 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|