C14H32N2O3 — CID 150895668
1-ethyl-1,2,2-tris[(2-methylpropan-2-yl)oxy]hydrazine (PubChem CID 150895668) has the molecular formula C14H32N2O3 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-ethyl-1,2,2-tris[(2-methylpropan-2-yl)oxy]hydrazine.
| Compound Name | 1-ethyl-1,2,2-tris[(2-methylpropan-2-yl)oxy]hydrazine |
|---|---|
| PubChem CID | 150895668 |
| Molecular Formula | C14H32N2O3 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.24 |
| IUPAC Name | 1-ethyl-1,2,2-tris[(2-methylpropan-2-yl)oxy]hydrazine |
| SMILES | CCN(OC(C)(C)C)N(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C14H32N2O3/c1-11-15(17-12(2,3)4)16(18-13(5,6)7)19-14(8,9)10/h11H2,1-10H3 |
| InChIKey | KYYDBZLRGNICMQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|