C14H10N2S — CID 1508979
1H-1,3-Benzimidazole, 1-(2-propynyl)-2-(2-thienyl)- (PubChem CID 1508979) has the molecular formula C14H10N2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 1-prop-2-ynyl-2-thiophen-2-ylbenzimidazole.
| Compound Name | 1H-1,3-Benzimidazole, 1-(2-propynyl)-2-(2-thienyl)- |
|---|---|
| PubChem CID | 1508979 |
| Molecular Formula | C14H10N2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-prop-2-ynyl-2-thiophen-2-ylbenzimidazole |
| SMILES | C#CCN1C2=CC=CC=C2N=C1C3=CC=CS3 |
| InChI | InChI=1S/C14H10N2S/c1-2-9-16-12-7-4-3-6-11(12)15-14(16)13-8-5-10-17-13/h1,3-8,10H,9H2 |
| InChIKey | LZQUAATYENFJJN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 321 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|