About (2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate
(2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate (PubChem CID 150902470) has the molecular formula C12H14ClNO4
and a molecular weight of 271.70 g/mol. Its IUPAC name is (2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate.
Molecular Properties
| Compound Name | (2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate |
| PubChem CID | 150902470 |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | (2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate |
| SMILES | COc1ccccc1CC(Cl)C(=O)OC(=O)CN |
| InChI | InChI=1S/C12H14ClNO4/c1-17-10-5-3-2-4-8(10)6-9(13)12(16)18-11(15)7-14/h2-5,9H,6-7,14H2,1H3 |
| InChIKey | LAHIGVLOYVUJPD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate?
The IUPAC name of (2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate (CID 150902470) is (2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate.
What is the SMILES notation for (2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate?
The canonical SMILES for (2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate is COc1ccccc1CC(Cl)C(=O)OC(=O)CN.
What is the InChIKey of (2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate?
The InChIKey is LAHIGVLOYVUJPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNO4/c1-17-10-5-3-2-4-8(10)6-9(13)12(16)18-11(15)7-14/h2-5,9H,6-7,14H2,1H3.
What are the key properties of (2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate?
(2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate has a molecular weight of 271.70 g/mol, XLogP of 0.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminoacetyl) 2-chloro-3-(2-methoxyphenyl)propanoate is sourced from PubChem (CID 150902470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).