C12H14O3 — CID 15091002
(3aR,8bS)-6,6-dimethyl-3a,5,7,8b-tetrahydrofuro[2,3-b][1]benzofuran-8-one (PubChem CID 15091002) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (3aR,8bS)-6,6-dimethyl-3a,5,7,8b-tetrahydrofuro[2,3-b][1]benzofuran-8-one.
| Compound Name | (3aR,8bS)-6,6-dimethyl-3a,5,7,8b-tetrahydrofuro[2,3-b][1]benzofuran-8-one |
|---|---|
| PubChem CID | 15091002 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (3aR,8bS)-6,6-dimethyl-3a,5,7,8b-tetrahydrofuro[2,3-b][1]benzofuran-8-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)O[C@H]1OC=C[C@@H]21 |
| InChI | InChI=1S/C12H14O3/c1-12(2)5-8(13)10-7-3-4-14-11(7)15-9(10)6-12/h3-4,7,11H,5-6H2,1-2H3/t7-,11+/m0/s1 |
| InChIKey | HRLNATCCIAHNAS-WRWORJQWSA-N |
| XLogP | 2.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |