C15H13N5O2 — CID 150917890
1-phenyl-3-(pyrazin-2-ylmethylamino)pyrazole-4-carboxylic acid (PubChem CID 150917890) has the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is 1-phenyl-3-(pyrazin-2-ylmethylamino)pyrazole-4-carboxylic acid.
| Compound Name | 1-phenyl-3-(pyrazin-2-ylmethylamino)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 150917890 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-phenyl-3-(pyrazin-2-ylmethylamino)pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(-c2ccccc2)nc1NCc1cnccn1 |
| InChI | InChI=1S/C15H13N5O2/c21-15(22)13-10-20(12-4-2-1-3-5-12)19-14(13)18-9-11-8-16-6-7-17-11/h1-8,10H,9H2,(H,18,19)(H,21,22) |
| InChIKey | LDJZPDZCOREPAJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |