C7H6I3NO — CID 15092
(3-amino-2,4,6-triiodophenyl)methanol (PubChem CID 15092) has the molecular formula C7H6I3NO and a molecular weight of 500.84 g/mol. Its IUPAC name is (3-amino-2,4,6-triiodophenyl)methanol.
| Compound Name | (3-amino-2,4,6-triiodophenyl)methanol |
|---|---|
| PubChem CID | 15092 |
| Molecular Formula | C7H6I3NO |
| Molecular Weight | 500.84 g/mol |
| Exact Mass | 500.76 |
| IUPAC Name | (3-amino-2,4,6-triiodophenyl)methanol |
| SMILES | Nc1c(I)cc(I)c(CO)c1I |
| InChI | InChI=1S/C7H6I3NO/c8-4-1-5(9)7(11)6(10)3(4)2-12/h1,12H,2,11H2 |
| InChIKey | VZQXILUNJAYEEK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.84 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|