C7H10N2O — CID 586680
(3,5-diaminophenyl)methanol (PubChem CID 586680) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is (3,5-diaminophenyl)methanol.
| Compound Name | (3,5-diaminophenyl)methanol |
|---|---|
| PubChem CID | 586680 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (3,5-diaminophenyl)methanol |
| SMILES | Nc1cc(N)cc(CO)c1 |
| InChI | InChI=1S/C7H10N2O/c8-6-1-5(4-10)2-7(9)3-6/h1-3,10H,4,8-9H2 |
| InChIKey | OHLQBRYVKXJYHZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|