C9H10N4O — CID 59313807
[3-amino-5-(1,2,4-triazol-1-yl)phenyl]methanol (PubChem CID 59313807) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is [3-amino-5-(1,2,4-triazol-1-yl)phenyl]methanol.
| Compound Name | [3-amino-5-(1,2,4-triazol-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 59313807 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | [3-amino-5-(1,2,4-triazol-1-yl)phenyl]methanol |
| SMILES | Nc1cc(CO)cc(-n2cncn2)c1 |
| InChI | InChI=1S/C9H10N4O/c10-8-1-7(4-14)2-9(3-8)13-6-11-5-12-13/h1-3,5-6,14H,4,10H2 |
| InChIKey | UETIIBMXFIOEOA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|