C17H18N4 — CID 87011517
3,5-dimethyl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]aniline (PubChem CID 87011517) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 3,5-dimethyl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]aniline.
| Compound Name | 3,5-dimethyl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 87011517 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 3,5-dimethyl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]aniline |
| SMILES | Cc1cc(C)cc(NCc2ccc(-n3cncn3)cc2)c1 |
| InChI | InChI=1S/C17H18N4/c1-13-7-14(2)9-16(8-13)19-10-15-3-5-17(6-4-15)21-12-18-11-20-21/h3-9,11-12,19H,10H2,1-2H3 |
| InChIKey | COMIVRAMHWHTBE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |