C16H15BrN4O — CID 87011161
N-[(5-bromo-2-methoxyphenyl)methyl]-4-(1,2,4-triazol-1-yl)aniline (PubChem CID 87011161) has the molecular formula C16H15BrN4O and a molecular weight of 359.23 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]-4-(1,2,4-triazol-1-yl)aniline.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]-4-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 87011161 |
| Molecular Formula | C16H15BrN4O |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]-4-(1,2,4-triazol-1-yl)aniline |
| SMILES | COc1ccc(Br)cc1CNc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C16H15BrN4O/c1-22-16-7-2-13(17)8-12(16)9-19-14-3-5-15(6-4-14)21-11-18-10-20-21/h2-8,10-11,19H,9H2,1H3 |
| InChIKey | VSSWBKCHEOJDPF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |