C10H7I2NO2 — CID 150928331
(6,7-diiodo-1H-indol-3-yl) acetate (PubChem CID 150928331) has the molecular formula C10H7I2NO2 and a molecular weight of 426.98 g/mol. Its IUPAC name is (6,7-diiodo-1H-indol-3-yl) acetate.
| Compound Name | (6,7-diiodo-1H-indol-3-yl) acetate |
|---|---|
| PubChem CID | 150928331 |
| Molecular Formula | C10H7I2NO2 |
| Molecular Weight | 426.98 g/mol |
| Exact Mass | 426.86 |
| IUPAC Name | (6,7-diiodo-1H-indol-3-yl) acetate |
| SMILES | CC(=O)Oc1c[nH]c2c(I)c(I)ccc12 |
| InChI | InChI=1S/C10H7I2NO2/c1-5(14)15-8-4-13-10-6(8)2-3-7(11)9(10)12/h2-4,13H,1H3 |
| InChIKey | LFMHHLPHIQUKRO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.98 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|