About (5-iodoisoquinolin-8-yl) acetate
(5-iodoisoquinolin-8-yl) acetate (PubChem CID 91621546) has the molecular formula C11H8INO2
and a molecular weight of 313.09 g/mol. Its IUPAC name is (5-iodoisoquinolin-8-yl) acetate.
Molecular Properties
| Compound Name | (5-iodoisoquinolin-8-yl) acetate |
| PubChem CID | 91621546 |
| Molecular Formula | C11H8INO2 |
| Molecular Weight | 313.09 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | (5-iodoisoquinolin-8-yl) acetate |
| SMILES | CC(=O)Oc1ccc(I)c2ccncc12 |
| InChI | InChI=1S/C11H8INO2/c1-7(14)15-11-3-2-10(12)8-4-5-13-6-9(8)11/h2-6H,1H3 |
| InChIKey | UGJWCRXARLXZDE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.09 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5-iodoisoquinolin-8-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-iodoisoquinolin-8-yl) acetate?
The IUPAC name of (5-iodoisoquinolin-8-yl) acetate (CID 91621546) is (5-iodoisoquinolin-8-yl) acetate.
What is the SMILES notation for (5-iodoisoquinolin-8-yl) acetate?
The canonical SMILES for (5-iodoisoquinolin-8-yl) acetate is CC(=O)Oc1ccc(I)c2ccncc12.
What is the InChIKey of (5-iodoisoquinolin-8-yl) acetate?
The InChIKey is UGJWCRXARLXZDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8INO2/c1-7(14)15-11-3-2-10(12)8-4-5-13-6-9(8)11/h2-6H,1H3.
What are the key properties of (5-iodoisoquinolin-8-yl) acetate?
(5-iodoisoquinolin-8-yl) acetate has a molecular weight of 313.09 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-iodoisoquinolin-8-yl) acetate is sourced from PubChem (CID 91621546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).