C16H15NO4 — CID 12617470
(5-acetyloxy-8,9-dihydro-7H-cyclopenta[h]isoquinolin-6-yl) acetate (PubChem CID 12617470) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is (5-acetyloxy-8,9-dihydro-7H-cyclopenta[h]isoquinolin-6-yl) acetate.
| Compound Name | (5-acetyloxy-8,9-dihydro-7H-cyclopenta[h]isoquinolin-6-yl) acetate |
|---|---|
| PubChem CID | 12617470 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (5-acetyloxy-8,9-dihydro-7H-cyclopenta[h]isoquinolin-6-yl) acetate |
| SMILES | CC(=O)Oc1c2c(c3cnccc3c1OC(C)=O)CCC2 |
| InChI | InChI=1S/C16H15NO4/c1-9(18)20-15-12-5-3-4-11(12)14-8-17-7-6-13(14)16(15)21-10(2)19/h6-8H,3-5H2,1-2H3 |
| InChIKey | LHMFRLDRTWWGTL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|