C8H15NO5Si — CID 150938879
1-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane-4-carboxylic acid (PubChem CID 150938879) has the molecular formula C8H15NO5Si and a molecular weight of 233.30 g/mol. Its IUPAC name is 1-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane-4-carboxylic acid.
| Compound Name | 1-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane-4-carboxylic acid |
|---|---|
| PubChem CID | 150938879 |
| Molecular Formula | C8H15NO5Si |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 1-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane-4-carboxylic acid |
| SMILES | C[Si]12OCCN(CCO1)C(C(=O)O)CO2 |
| InChI | InChI=1S/C8H15NO5Si/c1-15-12-4-2-9(3-5-13-15)7(6-14-15)8(10)11/h7H,2-6H2,1H3,(H,10,11) |
| InChIKey | LHPQHXWRPDRLNW-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|