About benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate
benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate (PubChem CID 15093918) has the molecular formula C17H23NO4
and a molecular weight of 305.37 g/mol. Its IUPAC name is benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate.
Molecular Properties
| Compound Name | benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate |
| PubChem CID | 15093918 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate |
| SMILES | CC1CC2CC(CO1)ON2CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c1-13-9-15-10-16(12-20-13)22-18(15)8-7-17(19)21-11-14-5-3-2-4-6-14/h2-6,13,15-16H,7-12H2,1H3 |
| InChIKey | QUYTXEWJGTZWFD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate?
The IUPAC name of benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate (CID 15093918) is benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate.
What is the SMILES notation for benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate?
The canonical SMILES for benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate is CC1CC2CC(CO1)ON2CCC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate?
The InChIKey is QUYTXEWJGTZWFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO4/c1-13-9-15-10-16(12-20-13)22-18(15)8-7-17(19)21-11-14-5-3-2-4-6-14/h2-6,13,15-16H,7-12H2,1H3.
What are the key properties of benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate?
benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate has a molecular weight of 305.37 g/mol, XLogP of 2.30, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-(4-methyl-3,8-dioxa-7-azabicyclo[4.2.1]nonan-7-yl)propanoate is sourced from PubChem (CID 15093918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).