C25H50N2O2 — CID 150948195
(Z)-1-(dimethylamino)-2-[(2-hydroxyethylamino)methyl]icos-11-en-3-one (PubChem CID 150948195) has the molecular formula C25H50N2O2 and a molecular weight of 410.69 g/mol. Its IUPAC name is (Z)-1-(dimethylamino)-2-[(2-hydroxyethylamino)methyl]icos-11-en-3-one.
| Compound Name | (Z)-1-(dimethylamino)-2-[(2-hydroxyethylamino)methyl]icos-11-en-3-one |
|---|---|
| PubChem CID | 150948195 |
| Molecular Formula | C25H50N2O2 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | (Z)-1-(dimethylamino)-2-[(2-hydroxyethylamino)methyl]icos-11-en-3-one |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(CNCCO)CN(C)C |
| InChI | InChI=1S/C25H50N2O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(29)24(23-27(2)3)22-26-20-21-28/h11-12,24,26,28H,4-10,13-23H2,1-3H3/b12-11- |
| InChIKey | LJNBOCZSCJVWQC-QXMHVHEDSA-N |
| XLogP | 5.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|