C45H86N2O5 — CID 87658864
[(9Z,29Z)-20-[(dimethylamino)methyl]-18,21-dioxooctatriaconta-9,29-dien-19-yl]-(2-hydroxyethyl)azanium acetate (PubChem CID 87658864) has the molecular formula C45H86N2O5 and a molecular weight of 735.19 g/mol. Its IUPAC name is [(9Z,29Z)-20-[(dimethylamino)methyl]-18,21-dioxooctatriaconta-9,29-dien-19-yl]-(2-hydroxyethyl)azanium acetate.
| Compound Name | [(9Z,29Z)-20-[(dimethylamino)methyl]-18,21-dioxooctatriaconta-9,29-dien-19-yl]-(2-hydroxyethyl)azanium acetate |
|---|---|
| PubChem CID | 87658864 |
| Molecular Formula | C45H86N2O5 |
| Molecular Weight | 735.19 g/mol |
| Exact Mass | 734.65 |
| IUPAC Name | [(9Z,29Z)-20-[(dimethylamino)methyl]-18,21-dioxooctatriaconta-9,29-dien-19-yl]-(2-hydroxyethyl)azanium acetate |
| SMILES | CC(=O)[O-].CCCCCCCC/C=C\CCCCCCCC(=O)C(CN(C)C)C([NH2+]CCO)C(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C43H82N2O3.C2H4O2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41(47)40(39-45(3)4)43(44-37-38-46)42(48)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2;1-2(3)4/h19-22,40,43-44,46H,5-18,23-39H2,1-4H3;1H3,(H,3,4)/b21-19-,22-20-; |
| InChIKey | CZGGZYUIYCFMMD-JDVCJPALSA-N |
| XLogP | 9.06 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.19 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|