C11H25O3PSe — CID 15094862
1-[2,2-dimethylpropoxy(methylselanyl)phosphoryl]oxy-2,2-dimethylpropane (PubChem CID 15094862) has the molecular formula C11H25O3PSe and a molecular weight of 315.25 g/mol. Its IUPAC name is 1-[2,2-dimethylpropoxy(methylselanyl)phosphoryl]oxy-2,2-dimethylpropane.
| Compound Name | 1-[2,2-dimethylpropoxy(methylselanyl)phosphoryl]oxy-2,2-dimethylpropane |
|---|---|
| PubChem CID | 15094862 |
| Molecular Formula | C11H25O3PSe |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-[2,2-dimethylpropoxy(methylselanyl)phosphoryl]oxy-2,2-dimethylpropane |
| SMILES | C[Se]P(=O)(OCC(C)(C)C)OCC(C)(C)C |
| InChI | InChI=1S/C11H25O3PSe/c1-10(2,3)8-13-15(12,16-7)14-9-11(4,5)6/h8-9H2,1-7H3 |
| InChIKey | LPKYLOHHVOJKOY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|