C14H31N2O2P — CID 66678116
1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-methylpiperazine (PubChem CID 66678116) has the molecular formula C14H31N2O2P and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-methylpiperazine.
| Compound Name | 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-methylpiperazine |
|---|---|
| PubChem CID | 66678116 |
| Molecular Formula | C14H31N2O2P |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-methylpiperazine |
| SMILES | CN1CCN(P(=O)(OCC(C)(C)C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H31N2O2P/c1-13(2,3)12-18-19(17,14(4,5)6)16-10-8-15(7)9-11-16/h8-12H2,1-7H3 |
| InChIKey | DQIKOYIANSELER-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|