C19H39N2O2P — CID 66678043
1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-1-ylpiperidine (PubChem CID 66678043) has the molecular formula C19H39N2O2P and a molecular weight of 358.51 g/mol. Its IUPAC name is 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-1-ylpiperidine.
| Compound Name | 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-1-ylpiperidine |
|---|---|
| PubChem CID | 66678043 |
| Molecular Formula | C19H39N2O2P |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-1-ylpiperidine |
| SMILES | CC(C)(C)COP(=O)(N1CCC(N2CCCCC2)CC1)C(C)(C)C |
| InChI | InChI=1S/C19H39N2O2P/c1-18(2,3)16-23-24(22,19(4,5)6)21-14-10-17(11-15-21)20-12-8-7-9-13-20/h17H,7-16H2,1-6H3 |
| InChIKey | SMYFYNKKBVLYRD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|