About chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride
chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride (PubChem CID 175068649) has the molecular formula C9H19Cl2N2O3P
and a molecular weight of 305.14 g/mol. Its IUPAC name is chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride.
Molecular Properties
| Compound Name | chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride |
| PubChem CID | 175068649 |
| Molecular Formula | C9H19Cl2N2O3P |
| Molecular Weight | 305.14 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride |
| SMILES | Cl.O=P(O)(Cl)ON1CCC(N2CCCC2)CC1 |
| InChI | InChI=1S/C9H18ClN2O3P.ClH/c10-16(13,14)15-12-7-3-9(4-8-12)11-5-1-2-6-11;/h9H,1-8H2,(H,13,14);1H |
| InChIKey | XOKUIXWUAFSCSV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.14 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride?
The IUPAC name of chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride (CID 175068649) is chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride.
What is the SMILES notation for chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride?
The canonical SMILES for chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride is Cl.O=P(O)(Cl)ON1CCC(N2CCCC2)CC1.
What is the InChIKey of chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride?
The InChIKey is XOKUIXWUAFSCSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18ClN2O3P.ClH/c10-16(13,14)15-12-7-3-9(4-8-12)11-5-1-2-6-11;/h9H,1-8H2,(H,13,14);1H.
What are the key properties of chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride?
chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride has a molecular weight of 305.14 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(4-pyrrolidin-1-ylpiperidin-1-yl)oxyphosphinic acid;hydrochloride is sourced from PubChem (CID 175068649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).