C25H30N4O5 — CID 150964990
[1-[(3-tert-butyl-6-phenylmethoxyquinolin-4-yl)-nitroamino]-2-methylpropan-2-yl] carbamate (PubChem CID 150964990) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is [1-[(3-tert-butyl-6-phenylmethoxyquinolin-4-yl)-nitroamino]-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-[(3-tert-butyl-6-phenylmethoxyquinolin-4-yl)-nitroamino]-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 150964990 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | [1-[(3-tert-butyl-6-phenylmethoxyquinolin-4-yl)-nitroamino]-2-methylpropan-2-yl] carbamate |
| SMILES | CC(C)(CN(c1c(C(C)(C)C)cnc2ccc(OCc3ccccc3)cc12)[N+](=O)[O-])OC(N)=O |
| InChI | InChI=1S/C25H30N4O5/c1-24(2,3)20-14-27-21-12-11-18(33-15-17-9-7-6-8-10-17)13-19(21)22(20)28(29(31)32)16-25(4,5)34-23(26)30/h6-14H,15-16H2,1-5H3,(H2,26,30) |
| InChIKey | LMWSHCXAQCOVRW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|