C16H20FN3 — CID 150968246
4-fluoro-3-[(1R,2R)-2-(piperazin-1-ylmethyl)cyclopropyl]-1H-indole (PubChem CID 150968246) has the molecular formula C16H20FN3 and a molecular weight of 273.35 g/mol. Its IUPAC name is 4-fluoro-3-[(1R,2R)-2-(piperazin-1-ylmethyl)cyclopropyl]-1H-indole.
| Compound Name | 4-fluoro-3-[(1R,2R)-2-(piperazin-1-ylmethyl)cyclopropyl]-1H-indole |
|---|---|
| PubChem CID | 150968246 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 4-fluoro-3-[(1R,2R)-2-(piperazin-1-ylmethyl)cyclopropyl]-1H-indole |
| SMILES | Fc1cccc2[nH]cc([C@@H]3C[C@H]3CN3CCNCC3)c12 |
| InChI | InChI=1S/C16H20FN3/c17-14-2-1-3-15-16(14)13(9-19-15)12-8-11(12)10-20-6-4-18-5-7-20/h1-3,9,11-12,18-19H,4-8,10H2/t11-,12+/m0/s1 |
| InChIKey | LNOBWZICMCNKNT-NWDGAFQWSA-N |
| XLogP | 2.32 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |