C17H22FN3O3S — CID 126789845
4-[[1-[(4-fluoro-1H-indol-3-yl)sulfonyl]pyrrolidin-2-yl]methyl]morpholine (PubChem CID 126789845) has the molecular formula C17H22FN3O3S and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[[1-[(4-fluoro-1H-indol-3-yl)sulfonyl]pyrrolidin-2-yl]methyl]morpholine.
| Compound Name | 4-[[1-[(4-fluoro-1H-indol-3-yl)sulfonyl]pyrrolidin-2-yl]methyl]morpholine |
|---|---|
| PubChem CID | 126789845 |
| Molecular Formula | C17H22FN3O3S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4-[[1-[(4-fluoro-1H-indol-3-yl)sulfonyl]pyrrolidin-2-yl]methyl]morpholine |
| SMILES | O=S(=O)(c1c[nH]c2cccc(F)c12)N1CCCC1CN1CCOCC1 |
| InChI | InChI=1S/C17H22FN3O3S/c18-14-4-1-5-15-17(14)16(11-19-15)25(22,23)21-6-2-3-13(21)12-20-7-9-24-10-8-20/h1,4-5,11,13,19H,2-3,6-10,12H2 |
| InChIKey | MCTUJAPDTBVCEJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |