C19H30O9 — CID 15098565
(2R,3R,4R,5R,6S)-2-[3-[4-(1,3-dihydroxypropan-2-yloxy)-3-methoxyphenyl]propoxy]-6-methyloxane-3,4,5-triol (PubChem CID 15098565) has the molecular formula C19H30O9 and a molecular weight of 402.44 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-[3-[4-(1,3-dihydroxypropan-2-yloxy)-3-methoxyphenyl]propoxy]-6-methyloxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R,6S)-2-[3-[4-(1,3-dihydroxypropan-2-yloxy)-3-methoxyphenyl]propoxy]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 15098565 |
| Molecular Formula | C19H30O9 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-[3-[4-(1,3-dihydroxypropan-2-yloxy)-3-methoxyphenyl]propoxy]-6-methyloxane-3,4,5-triol |
| SMILES | COc1cc(CCCO[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)ccc1OC(CO)CO |
| InChI | InChI=1S/C19H30O9/c1-11-16(22)17(23)18(24)19(27-11)26-7-3-4-12-5-6-14(15(8-12)25-2)28-13(9-20)10-21/h5-6,8,11,13,16-24H,3-4,7,9-10H2,1-2H3/t11-,16-,17+,18+,19+/m0/s1 |
| InChIKey | UOWOUQZNWSQHFV-MTSPLVIDSA-N |
| XLogP | -0.80 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|