C26H36O11 — CID 162826789
(2S,3R,4R,5R,6R)-2-[3-[4-[(1R,2R)-1,3-dihydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)propan-2-yl]oxyphenyl]propoxy]-6-methyloxane-3,4,5-triol (PubChem CID 162826789) has the molecular formula C26H36O11 and a molecular weight of 524.56 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-[3-[4-[(1R,2R)-1,3-dihydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)propan-2-yl]oxyphenyl]propoxy]-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6R)-2-[3-[4-[(1R,2R)-1,3-dihydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)propan-2-yl]oxyphenyl]propoxy]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 162826789 |
| Molecular Formula | C26H36O11 |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-[3-[4-[(1R,2R)-1,3-dihydroxy-1-(4-hydroxy-3,5-dimethoxyphenyl)propan-2-yl]oxyphenyl]propoxy]-6-methyloxane-3,4,5-triol |
| SMILES | COc1cc([C@@H](O)[C@@H](CO)Oc2ccc(CCCO[C@H]3O[C@H](C)[C@H](O)[C@@H](O)[C@H]3O)cc2)cc(OC)c1O |
| InChI | InChI=1S/C26H36O11/c1-14-21(28)24(31)25(32)26(36-14)35-10-4-5-15-6-8-17(9-7-15)37-20(13-27)22(29)16-11-18(33-2)23(30)19(12-16)34-3/h6-9,11-12,14,20-22,24-32H,4-5,10,13H2,1-3H3/t14-,20-,21+,22-,24-,25-,26+/m1/s1 |
| InChIKey | ILSHLZKMDXCARJ-SQQJQNIRSA-N |
| XLogP | 0.66 |
| TPSA | 167.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|