C18H11ClF3NS — CID 150986572
2-chloro-4-[(2,5-difluorophenyl)-(4-fluorophenyl)sulfanylmethyl]pyridine (PubChem CID 150986572) has the molecular formula C18H11ClF3NS and a molecular weight of 365.81 g/mol. Its IUPAC name is 2-chloro-4-[(2,5-difluorophenyl)-(4-fluorophenyl)sulfanylmethyl]pyridine.
| Compound Name | 2-chloro-4-[(2,5-difluorophenyl)-(4-fluorophenyl)sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 150986572 |
| Molecular Formula | C18H11ClF3NS |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 2-chloro-4-[(2,5-difluorophenyl)-(4-fluorophenyl)sulfanylmethyl]pyridine |
| SMILES | Fc1ccc(SC(c2ccnc(Cl)c2)c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C18H11ClF3NS/c19-17-9-11(7-8-23-17)18(15-10-13(21)3-6-16(15)22)24-14-4-1-12(20)2-5-14/h1-10,18H |
| InChIKey | LRFBZIIEJXLECQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|