C14H11F3OS — CID 60980220
1-(2,5-difluorophenyl)-2-(4-fluorophenyl)sulfanylethanol (PubChem CID 60980220) has the molecular formula C14H11F3OS and a molecular weight of 284.30 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-(4-fluorophenyl)sulfanylethanol.
| Compound Name | 1-(2,5-difluorophenyl)-2-(4-fluorophenyl)sulfanylethanol |
|---|---|
| PubChem CID | 60980220 |
| Molecular Formula | C14H11F3OS |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-(4-fluorophenyl)sulfanylethanol |
| SMILES | OC(CSc1ccc(F)cc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H11F3OS/c15-9-1-4-11(5-2-9)19-8-14(18)12-7-10(16)3-6-13(12)17/h1-7,14,18H,8H2 |
| InChIKey | OUIQLAVBFCYRRN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |