C13H25FNO4P — CID 15099089
(Z)-4-diethoxyphosphoryl-2-fluoro-N-(3-methylbutan-2-yl)but-2-enamide (PubChem CID 15099089) has the molecular formula C13H25FNO4P and a molecular weight of 309.32 g/mol. Its IUPAC name is (Z)-4-diethoxyphosphoryl-2-fluoro-N-(3-methylbutan-2-yl)but-2-enamide.
| Compound Name | (Z)-4-diethoxyphosphoryl-2-fluoro-N-(3-methylbutan-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 15099089 |
| Molecular Formula | C13H25FNO4P |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (Z)-4-diethoxyphosphoryl-2-fluoro-N-(3-methylbutan-2-yl)but-2-enamide |
| SMILES | CCOP(=O)(C/C=C(\F)C(=O)NC(C)C(C)C)OCC |
| InChI | InChI=1S/C13H25FNO4P/c1-6-18-20(17,19-7-2)9-8-12(14)13(16)15-11(5)10(3)4/h8,10-11H,6-7,9H2,1-5H3,(H,15,16)/b12-8- |
| InChIKey | DQDSDLVMDJQEHP-WQLSENKSSA-N |
| XLogP | 3.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|