C9H17NO3 — CID 151002782
4-(2-hydroxyethyl)-2-methylpiperidine-1-carboxylic acid (PubChem CID 151002782) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-2-methylpiperidine-1-carboxylic acid.
| Compound Name | 4-(2-hydroxyethyl)-2-methylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 151002782 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 4-(2-hydroxyethyl)-2-methylpiperidine-1-carboxylic acid |
| SMILES | CC1CC(CCO)CCN1C(=O)O |
| InChI | InChI=1S/C9H17NO3/c1-7-6-8(3-5-11)2-4-10(7)9(12)13/h7-8,11H,2-6H2,1H3,(H,12,13) |
| InChIKey | LULQPEZGTHQOHN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |