C15H19N5 — CID 151022593
5-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-1H-imidazol-2-amine (PubChem CID 151022593) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is 5-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-1H-imidazol-2-amine.
| Compound Name | 5-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 151022593 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 5-[3-[2-(dimethylamino)ethyl]-1H-indol-5-yl]-1H-imidazol-2-amine |
| SMILES | CN(C)CCc1c[nH]c2ccc(-c3cnc(N)[nH]3)cc12 |
| InChI | InChI=1S/C15H19N5/c1-20(2)6-5-11-8-17-13-4-3-10(7-12(11)13)14-9-18-15(16)19-14/h3-4,7-9,17H,5-6H2,1-2H3,(H3,16,18,19) |
| InChIKey | LYJVEBQRHBVKHO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 73.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |