C17H20N2O3S — CID 151025122
2-[[4-(aminomethyl)benzoyl]amino]-4-methyl-5-propylthiophene-3-carboxylic acid (PubChem CID 151025122) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)benzoyl]amino]-4-methyl-5-propylthiophene-3-carboxylic acid.
| Compound Name | 2-[[4-(aminomethyl)benzoyl]amino]-4-methyl-5-propylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 151025122 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-[[4-(aminomethyl)benzoyl]amino]-4-methyl-5-propylthiophene-3-carboxylic acid |
| SMILES | CCCc1sc(NC(=O)c2ccc(CN)cc2)c(C(=O)O)c1C |
| InChI | InChI=1S/C17H20N2O3S/c1-3-4-13-10(2)14(17(21)22)16(23-13)19-15(20)12-7-5-11(9-18)6-8-12/h5-8H,3-4,9,18H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | LYWRDAYMAHLXNO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |