C17H20O5 — CID 151027299
3-benzyl-1-methoxy-6-methylcyclohex-4-ene-1,3-dicarboxylic acid (PubChem CID 151027299) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is 3-benzyl-1-methoxy-6-methylcyclohex-4-ene-1,3-dicarboxylic acid.
| Compound Name | 3-benzyl-1-methoxy-6-methylcyclohex-4-ene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 151027299 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-benzyl-1-methoxy-6-methylcyclohex-4-ene-1,3-dicarboxylic acid |
| SMILES | COC1(C(=O)O)CC(Cc2ccccc2)(C(=O)O)C=CC1C |
| InChI | InChI=1S/C17H20O5/c1-12-8-9-16(14(18)19,10-13-6-4-3-5-7-13)11-17(12,22-2)15(20)21/h3-9,12H,10-11H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | LZHVWAUDRWESHG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|